C19H21N3O3 — CID 7443674
(2R,4R)-2-N-benzyl-4-hydroxy-1-N-phenylpyrrolidine-1,2-dicarboxamide (PubChem CID 7443674) has the molecular formula C19H21N3O3 and a molecular weight of 339.39 g/mol. Its IUPAC name is (2R,4R)-2-N-benzyl-4-hydroxy-1-N-phenylpyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R,4R)-2-N-benzyl-4-hydroxy-1-N-phenylpyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 7443674 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | (2R,4R)-2-N-benzyl-4-hydroxy-1-N-phenylpyrrolidine-1,2-dicarboxamide |
| SMILES | O=C(NCc1ccccc1)[C@H]1C[C@@H](O)CN1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C19H21N3O3/c23-16-11-17(18(24)20-12-14-7-3-1-4-8-14)22(13-16)19(25)21-15-9-5-2-6-10-15/h1-10,16-17,23H,11-13H2,(H,20,24)(H,21,25)/t16-,17-/m1/s1 |
| InChIKey | LQEBVUSYEMWLJW-IAGOWNOFSA-N |
| XLogP | 1.97 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |