C26H25F2N5O3 — CID 134085419
2-N-benzyl-1-N,4-N-bis(4-fluorophenyl)piperazine-1,2,4-tricarboxamide (PubChem CID 134085419) has the molecular formula C26H25F2N5O3 and a molecular weight of 493.51 g/mol. Its IUPAC name is 2-N-benzyl-1-N,4-N-bis(4-fluorophenyl)piperazine-1,2,4-tricarboxamide.
| Compound Name | 2-N-benzyl-1-N,4-N-bis(4-fluorophenyl)piperazine-1,2,4-tricarboxamide |
|---|---|
| PubChem CID | 134085419 |
| Molecular Formula | C26H25F2N5O3 |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | 2-N-benzyl-1-N,4-N-bis(4-fluorophenyl)piperazine-1,2,4-tricarboxamide |
| SMILES | O=C(NCc1ccccc1)C1CN(C(=O)Nc2ccc(F)cc2)CCN1C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C26H25F2N5O3/c27-19-6-10-21(11-7-19)30-25(35)32-14-15-33(26(36)31-22-12-8-20(28)9-13-22)23(17-32)24(34)29-16-18-4-2-1-3-5-18/h1-13,23H,14-17H2,(H,29,34)(H,30,35)(H,31,36) |
| InChIKey | BELSTJWQKGDIFM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |