C16H28N4S — CID 172873053
N-cyclohexyl-4-(1H-imidazol-5-yl)piperidine-1-carbothioamide;methane (PubChem CID 172873053) has the molecular formula C16H28N4S and a molecular weight of 308.49 g/mol. Its IUPAC name is N-cyclohexyl-4-(1H-imidazol-5-yl)piperidine-1-carbothioamide;methane.
| Compound Name | N-cyclohexyl-4-(1H-imidazol-5-yl)piperidine-1-carbothioamide;methane |
|---|---|
| PubChem CID | 172873053 |
| Molecular Formula | C16H28N4S |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | N-cyclohexyl-4-(1H-imidazol-5-yl)piperidine-1-carbothioamide;methane |
| SMILES | C.S=C(NC1CCCCC1)N1CCC(c2cnc[nH]2)CC1 |
| InChI | InChI=1S/C15H24N4S.CH4/c20-15(18-13-4-2-1-3-5-13)19-8-6-12(7-9-19)14-10-16-11-17-14;/h10-13H,1-9H2,(H,16,17)(H,18,20);1H4 |
| InChIKey | MPJKOAFGDIVQSD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|