C15H17FN4S — CID 10685941
N-(3-fluorophenyl)-4-(1H-imidazol-5-yl)piperidine-1-carbothioamide (PubChem CID 10685941) has the molecular formula C15H17FN4S and a molecular weight of 304.39 g/mol. Its IUPAC name is N-(3-fluorophenyl)-4-(1H-imidazol-5-yl)piperidine-1-carbothioamide.
| Compound Name | N-(3-fluorophenyl)-4-(1H-imidazol-5-yl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 10685941 |
| Molecular Formula | C15H17FN4S |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-(3-fluorophenyl)-4-(1H-imidazol-5-yl)piperidine-1-carbothioamide |
| SMILES | Fc1cccc(NC(=S)N2CCC(c3cnc[nH]3)CC2)c1 |
| InChI | InChI=1S/C15H17FN4S/c16-12-2-1-3-13(8-12)19-15(21)20-6-4-11(5-7-20)14-9-17-10-18-14/h1-3,8-11H,4-7H2,(H,17,18)(H,19,21) |
| InChIKey | FHHKJLWFZDIBNU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|