C29H34N6O2S2 — CID 10209837
4-[4-[(4-cyanophenyl)sulfonyl-(1H-imidazol-5-ylmethyl)amino]phenyl]-N-cyclohexylpiperidine-1-carbothioamide (PubChem CID 10209837) has the molecular formula C29H34N6O2S2 and a molecular weight of 562.77 g/mol. Its IUPAC name is 4-[4-[(4-cyanophenyl)sulfonyl-(1H-imidazol-5-ylmethyl)amino]phenyl]-N-cyclohexylpiperidine-1-carbothioamide.
| Compound Name | 4-[4-[(4-cyanophenyl)sulfonyl-(1H-imidazol-5-ylmethyl)amino]phenyl]-N-cyclohexylpiperidine-1-carbothioamide |
|---|---|
| PubChem CID | 10209837 |
| Molecular Formula | C29H34N6O2S2 |
| Molecular Weight | 562.77 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | 4-[4-[(4-cyanophenyl)sulfonyl-(1H-imidazol-5-ylmethyl)amino]phenyl]-N-cyclohexylpiperidine-1-carbothioamide |
| SMILES | N#Cc1ccc(S(=O)(=O)N(Cc2cnc[nH]2)c2ccc(C3CCN(C(=S)NC4CCCCC4)CC3)cc2)cc1 |
| InChI | InChI=1S/C29H34N6O2S2/c30-18-22-6-12-28(13-7-22)39(36,37)35(20-26-19-31-21-32-26)27-10-8-23(9-11-27)24-14-16-34(17-15-24)29(38)33-25-4-2-1-3-5-25/h6-13,19,21,24-25H,1-5,14-17,20H2,(H,31,32)(H,33,38) |
| InChIKey | VKYCGLMUZDTYPU-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.77 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|