C28H27N7O3S — CID 91301544
4-[4-[benzenesulfonyl(1H-imidazol-5-ylmethyl)amino]phenyl]-N-(3-cyanophenyl)piperazine-1-carboxamide (PubChem CID 91301544) has the molecular formula C28H27N7O3S and a molecular weight of 541.64 g/mol. Its IUPAC name is 4-[4-[benzenesulfonyl(1H-imidazol-5-ylmethyl)amino]phenyl]-N-(3-cyanophenyl)piperazine-1-carboxamide.
| Compound Name | 4-[4-[benzenesulfonyl(1H-imidazol-5-ylmethyl)amino]phenyl]-N-(3-cyanophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 91301544 |
| Molecular Formula | C28H27N7O3S |
| Molecular Weight | 541.64 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | 4-[4-[benzenesulfonyl(1H-imidazol-5-ylmethyl)amino]phenyl]-N-(3-cyanophenyl)piperazine-1-carboxamide |
| SMILES | N#Cc1cccc(NC(=O)N2CCN(c3ccc(N(Cc4cnc[nH]4)S(=O)(=O)c4ccccc4)cc3)CC2)c1 |
| InChI | InChI=1S/C28H27N7O3S/c29-18-22-5-4-6-23(17-22)32-28(36)34-15-13-33(14-16-34)25-9-11-26(12-10-25)35(20-24-19-30-21-31-24)39(37,38)27-7-2-1-3-8-27/h1-12,17,19,21H,13-16,20H2,(H,30,31)(H,32,36) |
| InChIKey | YARCFFPVGQSOAS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.64 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|