C12H18N4S — CID 21330739
N-cyclopentyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbothioamide (PubChem CID 21330739) has the molecular formula C12H18N4S and a molecular weight of 250.37 g/mol. Its IUPAC name is N-cyclopentyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbothioamide.
| Compound Name | N-cyclopentyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbothioamide |
|---|---|
| PubChem CID | 21330739 |
| Molecular Formula | C12H18N4S |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | N-cyclopentyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbothioamide |
| SMILES | S=C(NC1CCCC1)N1CCc2nc[nH]c2C1 |
| InChI | InChI=1S/C12H18N4S/c17-12(15-9-3-1-2-4-9)16-6-5-10-11(7-16)14-8-13-10/h8-9H,1-7H2,(H,13,14)(H,15,17) |
| InChIKey | FQEWFOGWQNZPFA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|