C19H22FN3OS — CID 108780477
N-cyclohexyl-3-(4-fluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridine-5-carbothioamide (PubChem CID 108780477) has the molecular formula C19H22FN3OS and a molecular weight of 359.47 g/mol. Its IUPAC name is N-cyclohexyl-3-(4-fluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridine-5-carbothioamide.
| Compound Name | N-cyclohexyl-3-(4-fluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridine-5-carbothioamide |
|---|---|
| PubChem CID | 108780477 |
| Molecular Formula | C19H22FN3OS |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | N-cyclohexyl-3-(4-fluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridine-5-carbothioamide |
| SMILES | Fc1ccc(-c2onc3c2CN(C(=S)NC2CCCCC2)CC3)cc1 |
| InChI | InChI=1S/C19H22FN3OS/c20-14-8-6-13(7-9-14)18-16-12-23(11-10-17(16)22-24-18)19(25)21-15-4-2-1-3-5-15/h6-9,15H,1-5,10-12H2,(H,21,25) |
| InChIKey | QMBJGCJUCDSYMR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|