C21H25NO5S — CID 9009834
N-[(3R)-1,1-dioxothiolan-3-yl]-2-(1-formylnaphthalen-2-yl)oxy-N-(2-methylpropyl)acetamide (PubChem CID 9009834) has the molecular formula C21H25NO5S and a molecular weight of 403.50 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-2-(1-formylnaphthalen-2-yl)oxy-N-(2-methylpropyl)acetamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-(1-formylnaphthalen-2-yl)oxy-N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 9009834 |
| Molecular Formula | C21H25NO5S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-(1-formylnaphthalen-2-yl)oxy-N-(2-methylpropyl)acetamide |
| SMILES | CC(C)CN(C(=O)COc1ccc2ccccc2c1C=O)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H25NO5S/c1-15(2)11-22(17-9-10-28(25,26)14-17)21(24)13-27-20-8-7-16-5-3-4-6-18(16)19(20)12-23/h3-8,12,15,17H,9-11,13-14H2,1-2H3/t17-/m1/s1 |
| InChIKey | BBYRGSLBGDQTIW-QGZVFWFLSA-N |
| XLogP | 2.70 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|