C22H26N2O5S — CID 40919641
N-benzyl-2-[2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethoxy]benzamide (PubChem CID 40919641) has the molecular formula C22H26N2O5S and a molecular weight of 430.53 g/mol. Its IUPAC name is N-benzyl-2-[2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethoxy]benzamide.
| Compound Name | N-benzyl-2-[2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 40919641 |
| Molecular Formula | C22H26N2O5S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | N-benzyl-2-[2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethoxy]benzamide |
| SMILES | CCN(C(=O)COc1ccccc1C(=O)NCc1ccccc1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H26N2O5S/c1-2-24(18-12-13-30(27,28)16-18)21(25)15-29-20-11-7-6-10-19(20)22(26)23-14-17-8-4-3-5-9-17/h3-11,18H,2,12-16H2,1H3,(H,23,26)/t18-/m1/s1 |
| InChIKey | ZKQYBFKPRSMBDS-GOSISDBHSA-N |
| XLogP | 2.03 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |