C24H29O5- — CID 11874844
4-[(2S,3S,4R)-2,3,4-trimethyl-2-[(2-oxochromen-7-yl)oxymethyl]cyclohexylidene]pentanoate (PubChem CID 11874844) has the molecular formula C24H29O5- and a molecular weight of 397.49 g/mol. Its IUPAC name is 4-[(2S,3S,4R)-2,3,4-trimethyl-2-[(2-oxochromen-7-yl)oxymethyl]cyclohexylidene]pentanoate.
| Compound Name | 4-[(2S,3S,4R)-2,3,4-trimethyl-2-[(2-oxochromen-7-yl)oxymethyl]cyclohexylidene]pentanoate |
|---|---|
| PubChem CID | 11874844 |
| Molecular Formula | C24H29O5- |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 4-[(2S,3S,4R)-2,3,4-trimethyl-2-[(2-oxochromen-7-yl)oxymethyl]cyclohexylidene]pentanoate |
| SMILES | CC(CCC(=O)[O-])=C1CC[C@@H](C)[C@H](C)[C@]1(C)COc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C24H30O5/c1-15-5-10-20(16(2)6-11-22(25)26)24(4,17(15)3)14-28-19-9-7-18-8-12-23(27)29-21(18)13-19/h7-9,12-13,15,17H,5-6,10-11,14H2,1-4H3,(H,25,26)/p-1/t15-,17+,24+/m1/s1 |
| InChIKey | GABUDCHNRRTVEJ-RLJZQAMKSA-M |
| XLogP | 4.09 |
| TPSA | 79.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|