C19H21NO5 — CID 86990683
N-cyclopropyl-2-(2-oxochromen-7-yl)oxy-N-(oxolan-3-ylmethyl)acetamide (PubChem CID 86990683) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is N-cyclopropyl-2-(2-oxochromen-7-yl)oxy-N-(oxolan-3-ylmethyl)acetamide.
| Compound Name | N-cyclopropyl-2-(2-oxochromen-7-yl)oxy-N-(oxolan-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 86990683 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | N-cyclopropyl-2-(2-oxochromen-7-yl)oxy-N-(oxolan-3-ylmethyl)acetamide |
| SMILES | O=C(COc1ccc2ccc(=O)oc2c1)N(CC1CCOC1)C1CC1 |
| InChI | InChI=1S/C19H21NO5/c21-18(20(15-3-4-15)10-13-7-8-23-11-13)12-24-16-5-1-14-2-6-19(22)25-17(14)9-16/h1-2,5-6,9,13,15H,3-4,7-8,10-12H2 |
| InChIKey | PNBCAHIQJWBECK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|