C23H24N2O3S2 — CID 78881149
3-methyl-N-[2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl]-N-phenylbenzenesulfonamide (PubChem CID 78881149) has the molecular formula C23H24N2O3S2 and a molecular weight of 440.59 g/mol. Its IUPAC name is 3-methyl-N-[2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl]-N-phenylbenzenesulfonamide.
| Compound Name | 3-methyl-N-[2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl]-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 78881149 |
| Molecular Formula | C23H24N2O3S2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 3-methyl-N-[2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl]-N-phenylbenzenesulfonamide |
| SMILES | Cc1cccc(S(=O)(=O)N(CC(=O)N2CCCC2c2cccs2)c2ccccc2)c1 |
| InChI | InChI=1S/C23H24N2O3S2/c1-18-8-5-11-20(16-18)30(27,28)25(19-9-3-2-4-10-19)17-23(26)24-14-6-12-21(24)22-13-7-15-29-22/h2-5,7-11,13,15-16,21H,6,12,14,17H2,1H3 |
| InChIKey | UQWNBMOPBCANLG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |