C19H23FN2OS — CID 78808542
2-[ethyl-[(3-fluorophenyl)methyl]amino]-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone (PubChem CID 78808542) has the molecular formula C19H23FN2OS and a molecular weight of 346.47 g/mol. Its IUPAC name is 2-[ethyl-[(3-fluorophenyl)methyl]amino]-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone.
| Compound Name | 2-[ethyl-[(3-fluorophenyl)methyl]amino]-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone |
|---|---|
| PubChem CID | 78808542 |
| Molecular Formula | C19H23FN2OS |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 2-[ethyl-[(3-fluorophenyl)methyl]amino]-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone |
| SMILES | CCN(CC(=O)N1CCCC1c1cccs1)Cc1cccc(F)c1 |
| InChI | InChI=1S/C19H23FN2OS/c1-2-21(13-15-6-3-7-16(20)12-15)14-19(23)22-10-4-8-17(22)18-9-5-11-24-18/h3,5-7,9,11-12,17H,2,4,8,10,13-14H2,1H3 |
| InChIKey | FLIJHUGPEACYFY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |