C21H26N2OS — CID 55591125
2-[cyclopropyl-[(4-methylphenyl)methyl]amino]-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone (PubChem CID 55591125) has the molecular formula C21H26N2OS and a molecular weight of 354.52 g/mol. Its IUPAC name is 2-[cyclopropyl-[(4-methylphenyl)methyl]amino]-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone.
| Compound Name | 2-[cyclopropyl-[(4-methylphenyl)methyl]amino]-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone |
|---|---|
| PubChem CID | 55591125 |
| Molecular Formula | C21H26N2OS |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 2-[cyclopropyl-[(4-methylphenyl)methyl]amino]-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone |
| SMILES | Cc1ccc(CN(CC(=O)N2CCCC2c2cccs2)C2CC2)cc1 |
| InChI | InChI=1S/C21H26N2OS/c1-16-6-8-17(9-7-16)14-22(18-10-11-18)15-21(24)23-12-2-4-19(23)20-5-3-13-25-20/h3,5-9,13,18-19H,2,4,10-12,14-15H2,1H3 |
| InChIKey | QIQNDNITCGDKSU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |