C17H19NOS — CID 50747412
1-[2-(4-methylphenyl)pyrrolidin-1-yl]-2-thiophen-2-ylethanone (PubChem CID 50747412) has the molecular formula C17H19NOS and a molecular weight of 285.41 g/mol. Its IUPAC name is 1-[2-(4-methylphenyl)pyrrolidin-1-yl]-2-thiophen-2-ylethanone.
| Compound Name | 1-[2-(4-methylphenyl)pyrrolidin-1-yl]-2-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 50747412 |
| Molecular Formula | C17H19NOS |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 1-[2-(4-methylphenyl)pyrrolidin-1-yl]-2-thiophen-2-ylethanone |
| SMILES | Cc1ccc(C2CCCN2C(=O)Cc2cccs2)cc1 |
| InChI | InChI=1S/C17H19NOS/c1-13-6-8-14(9-7-13)16-5-2-10-18(16)17(19)12-15-4-3-11-20-15/h3-4,6-9,11,16H,2,5,10,12H2,1H3 |
| InChIKey | DPQIDDLRPZFVRE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |