C15H17N3OS — CID 124997340
1-[(2R)-2-(6-methylpyrazin-2-yl)pyrrolidin-1-yl]-2-thiophen-2-ylethanone (PubChem CID 124997340) has the molecular formula C15H17N3OS and a molecular weight of 287.39 g/mol. Its IUPAC name is 1-[(2R)-2-(6-methylpyrazin-2-yl)pyrrolidin-1-yl]-2-thiophen-2-ylethanone.
| Compound Name | 1-[(2R)-2-(6-methylpyrazin-2-yl)pyrrolidin-1-yl]-2-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 124997340 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 1-[(2R)-2-(6-methylpyrazin-2-yl)pyrrolidin-1-yl]-2-thiophen-2-ylethanone |
| SMILES | Cc1cncc([C@H]2CCCN2C(=O)Cc2cccs2)n1 |
| InChI | InChI=1S/C15H17N3OS/c1-11-9-16-10-13(17-11)14-5-2-6-18(14)15(19)8-12-4-3-7-20-12/h3-4,7,9-10,14H,2,5-6,8H2,1H3/t14-/m1/s1 |
| InChIKey | QZMULDPENIVMNU-CQSZACIVSA-N |
| XLogP | 2.75 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |