C18H17N3OS — CID 110114137
1-benzothiophen-2-yl-[2-(6-methylpyrazin-2-yl)pyrrolidin-1-yl]methanone (PubChem CID 110114137) has the molecular formula C18H17N3OS and a molecular weight of 323.42 g/mol. Its IUPAC name is 1-benzothiophen-2-yl-[2-(6-methylpyrazin-2-yl)pyrrolidin-1-yl]methanone.
| Compound Name | 1-benzothiophen-2-yl-[2-(6-methylpyrazin-2-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 110114137 |
| Molecular Formula | C18H17N3OS |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 1-benzothiophen-2-yl-[2-(6-methylpyrazin-2-yl)pyrrolidin-1-yl]methanone |
| SMILES | Cc1cncc(C2CCCN2C(=O)c2cc3ccccc3s2)n1 |
| InChI | InChI=1S/C18H17N3OS/c1-12-10-19-11-14(20-12)15-6-4-8-21(15)18(22)17-9-13-5-2-3-7-16(13)23-17/h2-3,5,7,9-11,15H,4,6,8H2,1H3 |
| InChIKey | ANBSQHULRGGSTG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |