C26H24N4O3S — CID 139489528
N-[2-[4-[(4-cyano-3-methyl-1-phenylpyrazol-5-yl)methoxy]phenyl]ethyl]benzenesulfonamide (PubChem CID 139489528) has the molecular formula C26H24N4O3S and a molecular weight of 472.57 g/mol. Its IUPAC name is N-[2-[4-[(4-cyano-3-methyl-1-phenylpyrazol-5-yl)methoxy]phenyl]ethyl]benzenesulfonamide.
| Compound Name | N-[2-[4-[(4-cyano-3-methyl-1-phenylpyrazol-5-yl)methoxy]phenyl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 139489528 |
| Molecular Formula | C26H24N4O3S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | N-[2-[4-[(4-cyano-3-methyl-1-phenylpyrazol-5-yl)methoxy]phenyl]ethyl]benzenesulfonamide |
| SMILES | Cc1nn(-c2ccccc2)c(COc2ccc(CCNS(=O)(=O)c3ccccc3)cc2)c1C#N |
| InChI | InChI=1S/C26H24N4O3S/c1-20-25(18-27)26(30(29-20)22-8-4-2-5-9-22)19-33-23-14-12-21(13-15-23)16-17-28-34(31,32)24-10-6-3-7-11-24/h2-15,28H,16-17,19H2,1H3 |
| InChIKey | QIVSQXUTEPWQQX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |