C23H19N3O3 — CID 30909183
5-[(4-ethyl-2-oxochromen-7-yl)oxymethyl]-3-methyl-1-phenylpyrazole-4-carbonitrile (PubChem CID 30909183) has the molecular formula C23H19N3O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is 5-[(4-ethyl-2-oxochromen-7-yl)oxymethyl]-3-methyl-1-phenylpyrazole-4-carbonitrile.
| Compound Name | 5-[(4-ethyl-2-oxochromen-7-yl)oxymethyl]-3-methyl-1-phenylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 30909183 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 5-[(4-ethyl-2-oxochromen-7-yl)oxymethyl]-3-methyl-1-phenylpyrazole-4-carbonitrile |
| SMILES | CCc1cc(=O)oc2cc(OCc3c(C#N)c(C)nn3-c3ccccc3)ccc12 |
| InChI | InChI=1S/C23H19N3O3/c1-3-16-11-23(27)29-22-12-18(9-10-19(16)22)28-14-21-20(13-24)15(2)25-26(21)17-7-5-4-6-8-17/h4-12H,3,14H2,1-2H3 |
| InChIKey | WQCKVKUOVZTFBK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 81.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|