C24H25N3O3 — CID 159646520
tert-butyl 2-[4-[(4-cyano-3-methyl-1-phenylpyrazol-5-yl)methoxy]phenyl]acetate (PubChem CID 159646520) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is tert-butyl 2-[4-[(4-cyano-3-methyl-1-phenylpyrazol-5-yl)methoxy]phenyl]acetate.
| Compound Name | tert-butyl 2-[4-[(4-cyano-3-methyl-1-phenylpyrazol-5-yl)methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 159646520 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | tert-butyl 2-[4-[(4-cyano-3-methyl-1-phenylpyrazol-5-yl)methoxy]phenyl]acetate |
| SMILES | Cc1nn(-c2ccccc2)c(COc2ccc(CC(=O)OC(C)(C)C)cc2)c1C#N |
| InChI | InChI=1S/C24H25N3O3/c1-17-21(15-25)22(27(26-17)19-8-6-5-7-9-19)16-29-20-12-10-18(11-13-20)14-23(28)30-24(2,3)4/h5-13H,14,16H2,1-4H3 |
| InChIKey | XGYSJTJWLWDKFW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 77.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |