C22H20N4O4 — CID 27916447
(4-cyano-3-methyl-1-phenylpyrazol-5-yl)methyl 2-[(2-phenoxyacetyl)amino]acetate (PubChem CID 27916447) has the molecular formula C22H20N4O4 and a molecular weight of 404.43 g/mol. Its IUPAC name is (4-cyano-3-methyl-1-phenylpyrazol-5-yl)methyl 2-[(2-phenoxyacetyl)amino]acetate.
| Compound Name | (4-cyano-3-methyl-1-phenylpyrazol-5-yl)methyl 2-[(2-phenoxyacetyl)amino]acetate |
|---|---|
| PubChem CID | 27916447 |
| Molecular Formula | C22H20N4O4 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | (4-cyano-3-methyl-1-phenylpyrazol-5-yl)methyl 2-[(2-phenoxyacetyl)amino]acetate |
| SMILES | Cc1nn(-c2ccccc2)c(COC(=O)CNC(=O)COc2ccccc2)c1C#N |
| InChI | InChI=1S/C22H20N4O4/c1-16-19(12-23)20(26(25-16)17-8-4-2-5-9-17)14-30-22(28)13-24-21(27)15-29-18-10-6-3-7-11-18/h2-11H,13-15H2,1H3,(H,24,27) |
| InChIKey | CUHAAFFGCDRGAE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 106.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |