C19H15ClN4O2 — CID 42490131
(4-cyano-3-methyl-1-phenylpyrazol-5-yl)methyl 3-amino-4-chlorobenzoate (PubChem CID 42490131) has the molecular formula C19H15ClN4O2 and a molecular weight of 366.81 g/mol. Its IUPAC name is (4-cyano-3-methyl-1-phenylpyrazol-5-yl)methyl 3-amino-4-chlorobenzoate.
| Compound Name | (4-cyano-3-methyl-1-phenylpyrazol-5-yl)methyl 3-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 42490131 |
| Molecular Formula | C19H15ClN4O2 |
| Molecular Weight | 366.81 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | (4-cyano-3-methyl-1-phenylpyrazol-5-yl)methyl 3-amino-4-chlorobenzoate |
| SMILES | Cc1nn(-c2ccccc2)c(COC(=O)c2ccc(Cl)c(N)c2)c1C#N |
| InChI | InChI=1S/C19H15ClN4O2/c1-12-15(10-21)18(24(23-12)14-5-3-2-4-6-14)11-26-19(25)13-7-8-16(20)17(22)9-13/h2-9H,11,22H2,1H3 |
| InChIKey | SBHDAZMWUPSWDH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 93.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.81 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|