C26H22N4O4S — CID 46606321
(4-cyano-3-methyl-1-phenylpyrazol-5-yl)methyl 4-[methyl(phenyl)sulfamoyl]benzoate (PubChem CID 46606321) has the molecular formula C26H22N4O4S and a molecular weight of 486.55 g/mol. Its IUPAC name is (4-cyano-3-methyl-1-phenylpyrazol-5-yl)methyl 4-[methyl(phenyl)sulfamoyl]benzoate.
| Compound Name | (4-cyano-3-methyl-1-phenylpyrazol-5-yl)methyl 4-[methyl(phenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 46606321 |
| Molecular Formula | C26H22N4O4S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | (4-cyano-3-methyl-1-phenylpyrazol-5-yl)methyl 4-[methyl(phenyl)sulfamoyl]benzoate |
| SMILES | Cc1nn(-c2ccccc2)c(COC(=O)c2ccc(S(=O)(=O)N(C)c3ccccc3)cc2)c1C#N |
| InChI | InChI=1S/C26H22N4O4S/c1-19-24(17-27)25(30(28-19)22-11-7-4-8-12-22)18-34-26(31)20-13-15-23(16-14-20)35(32,33)29(2)21-9-5-3-6-10-21/h3-16H,18H2,1-2H3 |
| InChIKey | DYRIINKXHQZQQY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 105.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |