C25H24N4O5S — CID 55398829
(4-cyano-3-methyl-1-phenylpyrazol-5-yl)methyl (E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate (PubChem CID 55398829) has the molecular formula C25H24N4O5S and a molecular weight of 492.56 g/mol. Its IUPAC name is (4-cyano-3-methyl-1-phenylpyrazol-5-yl)methyl (E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate.
| Compound Name | (4-cyano-3-methyl-1-phenylpyrazol-5-yl)methyl (E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 55398829 |
| Molecular Formula | C25H24N4O5S |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | (4-cyano-3-methyl-1-phenylpyrazol-5-yl)methyl (E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate |
| SMILES | Cc1nn(-c2ccccc2)c(COC(=O)/C=C/c2ccc(S(=O)(=O)N3CCOCC3)cc2)c1C#N |
| InChI | InChI=1S/C25H24N4O5S/c1-19-23(17-26)24(29(27-19)21-5-3-2-4-6-21)18-34-25(30)12-9-20-7-10-22(11-8-20)35(31,32)28-13-15-33-16-14-28/h2-12H,13-16,18H2,1H3/b12-9+ |
| InChIKey | OAKDTUYCEIQXEY-FMIVXFBMSA-N |
| XLogP | 2.83 |
| TPSA | 114.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|