C19H18N4O — CID 2104000
5-[(4-methoxyanilino)methyl]-3-methyl-1-phenylpyrazole-4-carbonitrile (PubChem CID 2104000) has the molecular formula C19H18N4O and a molecular weight of 318.38 g/mol. Its IUPAC name is 5-[(4-methoxyanilino)methyl]-3-methyl-1-phenylpyrazole-4-carbonitrile.
| Compound Name | 5-[(4-methoxyanilino)methyl]-3-methyl-1-phenylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 2104000 |
| Molecular Formula | C19H18N4O |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 5-[(4-methoxyanilino)methyl]-3-methyl-1-phenylpyrazole-4-carbonitrile |
| SMILES | COc1ccc(NCc2c(C#N)c(C)nn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H18N4O/c1-14-18(12-20)19(23(22-14)16-6-4-3-5-7-16)13-21-15-8-10-17(24-2)11-9-15/h3-11,21H,13H2,1-2H3 |
| InChIKey | RNHQMKJGWSEEQO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 62.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|