C30H25N3P+ — CID 71813499
(4-cyano-3-methyl-1-phenylpyrazol-5-yl)methyl-triphenylphosphanium (PubChem CID 71813499) has the molecular formula C30H25N3P+ and a molecular weight of 458.53 g/mol. Its IUPAC name is (4-cyano-3-methyl-1-phenylpyrazol-5-yl)methyl-triphenylphosphanium.
| Compound Name | (4-cyano-3-methyl-1-phenylpyrazol-5-yl)methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 71813499 |
| Molecular Formula | C30H25N3P+ |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | (4-cyano-3-methyl-1-phenylpyrazol-5-yl)methyl-triphenylphosphanium |
| SMILES | Cc1nn(-c2ccccc2)c(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)c1C#N |
| InChI | InChI=1S/C30H25N3P/c1-24-29(22-31)30(33(32-24)25-14-6-2-7-15-25)23-34(26-16-8-3-9-17-26,27-18-10-4-11-19-27)28-20-12-5-13-21-28/h2-21H,23H2,1H3/q+1 |
| InChIKey | GDELMQYFXCABMJ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|