C14H14N4O — CID 85450951
ethyl N-(4-cyano-3-methyl-1-phenylpyrazol-5-yl)methanimidate (PubChem CID 85450951) has the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. Its IUPAC name is ethyl N-(4-cyano-3-methyl-1-phenylpyrazol-5-yl)methanimidate.
| Compound Name | ethyl N-(4-cyano-3-methyl-1-phenylpyrazol-5-yl)methanimidate |
|---|---|
| PubChem CID | 85450951 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | ethyl N-(4-cyano-3-methyl-1-phenylpyrazol-5-yl)methanimidate |
| SMILES | CCOC=Nc1c(C#N)c(C)nn1-c1ccccc1 |
| InChI | InChI=1S/C14H14N4O/c1-3-19-10-16-14-13(9-15)11(2)17-18(14)12-7-5-4-6-8-12/h4-8,10H,3H2,1-2H3 |
| InChIKey | FCHVVUMHVOQECF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 63.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|