C16H23N5 — CID 170878384
N'-[4-(3-aminopropyl)-3-methyl-1-phenylpyrazol-5-yl]-N,N-dimethylmethanimidamide (PubChem CID 170878384) has the molecular formula C16H23N5 and a molecular weight of 285.40 g/mol. Its IUPAC name is N'-[4-(3-aminopropyl)-3-methyl-1-phenylpyrazol-5-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[4-(3-aminopropyl)-3-methyl-1-phenylpyrazol-5-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 170878384 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.40 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | N'-[4-(3-aminopropyl)-3-methyl-1-phenylpyrazol-5-yl]-N,N-dimethylmethanimidamide |
| SMILES | Cc1nn(-c2ccccc2)c(/N=C/N(C)C)c1CCCN |
| InChI | InChI=1S/C16H23N5/c1-13-15(10-7-11-17)16(18-12-20(2)3)21(19-13)14-8-5-4-6-9-14/h4-6,8-9,12H,7,10-11,17H2,1-3H3/b18-12+ |
| InChIKey | YFEZJXWIMAERIO-LDADJPATSA-N |
| XLogP | 2.29 |
| TPSA | 59.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|