C16H14N6O — CID 10494848
ethyl (1E)-N-(5-cyano-3-methyl-1-phenylpyrazolo[3,4-b]pyrazin-6-yl)methanimidate (PubChem CID 10494848) has the molecular formula C16H14N6O and a molecular weight of 306.33 g/mol. Its IUPAC name is ethyl (1E)-N-(5-cyano-3-methyl-1-phenylpyrazolo[3,4-b]pyrazin-6-yl)methanimidate.
| Compound Name | ethyl (1E)-N-(5-cyano-3-methyl-1-phenylpyrazolo[3,4-b]pyrazin-6-yl)methanimidate |
|---|---|
| PubChem CID | 10494848 |
| Molecular Formula | C16H14N6O |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | ethyl (1E)-N-(5-cyano-3-methyl-1-phenylpyrazolo[3,4-b]pyrazin-6-yl)methanimidate |
| SMILES | CCO/C=N/c1nc2c(nc1C#N)c(C)nn2-c1ccccc1 |
| InChI | InChI=1S/C16H14N6O/c1-3-23-10-18-15-13(9-17)19-14-11(2)21-22(16(14)20-15)12-7-5-4-6-8-12/h4-8,10H,3H2,1-2H3/b18-10+ |
| InChIKey | HVRVDWWOARQRFD-VCHYOVAHSA-N |
| XLogP | 2.69 |
| TPSA | 88.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|