C16H17N7S — CID 24619016
3-methyl-1-phenyl-5-[(1-propan-2-yltetrazol-5-yl)sulfanylmethyl]pyrazole-4-carbonitrile (PubChem CID 24619016) has the molecular formula C16H17N7S and a molecular weight of 339.43 g/mol. Its IUPAC name is 3-methyl-1-phenyl-5-[(1-propan-2-yltetrazol-5-yl)sulfanylmethyl]pyrazole-4-carbonitrile.
| Compound Name | 3-methyl-1-phenyl-5-[(1-propan-2-yltetrazol-5-yl)sulfanylmethyl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 24619016 |
| Molecular Formula | C16H17N7S |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 3-methyl-1-phenyl-5-[(1-propan-2-yltetrazol-5-yl)sulfanylmethyl]pyrazole-4-carbonitrile |
| SMILES | Cc1nn(-c2ccccc2)c(CSc2nnnn2C(C)C)c1C#N |
| InChI | InChI=1S/C16H17N7S/c1-11(2)22-16(18-20-21-22)24-10-15-14(9-17)12(3)19-23(15)13-7-5-4-6-8-13/h4-8,11H,10H2,1-3H3 |
| InChIKey | WQGNMQUPQDRSKI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 85.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |