C26H25N7O2S — CID 143927348
1-amino-3-[(4-methoxyanilino)methyl]naphthalen-2-ol;5-amino-3-methyl-1-(1,3-thiazol-2-yl)pyrazole-4-carbonitrile (PubChem CID 143927348) has the molecular formula C26H25N7O2S and a molecular weight of 499.60 g/mol. Its IUPAC name is 1-amino-3-[(4-methoxyanilino)methyl]naphthalen-2-ol;5-amino-3-methyl-1-(1,3-thiazol-2-yl)pyrazole-4-carbonitrile.
| Compound Name | 1-amino-3-[(4-methoxyanilino)methyl]naphthalen-2-ol;5-amino-3-methyl-1-(1,3-thiazol-2-yl)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 143927348 |
| Molecular Formula | C26H25N7O2S |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | 1-amino-3-[(4-methoxyanilino)methyl]naphthalen-2-ol;5-amino-3-methyl-1-(1,3-thiazol-2-yl)pyrazole-4-carbonitrile |
| SMILES | COc1ccc(NCc2cc3ccccc3c(N)c2O)cc1.Cc1nn(-c2nccs2)c(N)c1C#N |
| InChI | InChI=1S/C18H18N2O2.C8H7N5S/c1-22-15-8-6-14(7-9-15)20-11-13-10-12-4-2-3-5-16(12)17(19)18(13)21;1-5-6(4-9)7(10)13(12-5)8-11-2-3-14-8/h2-10,20-21H,11,19H2,1H3;2-3H,10H2,1H3 |
| InChIKey | FLAUJMKYUJVWOP-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 148.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|