C12H15N5O — CID 46888181
5-[(4-methoxyanilino)methyl]pyrimidine-2,4-diamine (PubChem CID 46888181) has the molecular formula C12H15N5O and a molecular weight of 245.29 g/mol. Its IUPAC name is 5-[(4-methoxyanilino)methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-[(4-methoxyanilino)methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 46888181 |
| Molecular Formula | C12H15N5O |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 5-[(4-methoxyanilino)methyl]pyrimidine-2,4-diamine |
| SMILES | COc1ccc(NCc2cnc(N)nc2N)cc1 |
| InChI | InChI=1S/C12H15N5O/c1-18-10-4-2-9(3-5-10)15-6-8-7-16-12(14)17-11(8)13/h2-5,7,15H,6H2,1H3,(H4,13,14,16,17) |
| InChIKey | LUBPBICIXFVWQZ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|