C35H30N8O4 — CID 143927359
N-[4-(5-amino-4-cyano-1-pyrimidin-2-ylpyrrol-3-yl)phenyl]acetamide;4-amino-3-hydroxy-N-(4-methoxyphenyl)naphthalene-2-carboxamide (PubChem CID 143927359) has the molecular formula C35H30N8O4 and a molecular weight of 626.68 g/mol. Its IUPAC name is N-[4-(5-amino-4-cyano-1-pyrimidin-2-ylpyrrol-3-yl)phenyl]acetamide;4-amino-3-hydroxy-N-(4-methoxyphenyl)naphthalene-2-carboxamide.
| Compound Name | N-[4-(5-amino-4-cyano-1-pyrimidin-2-ylpyrrol-3-yl)phenyl]acetamide;4-amino-3-hydroxy-N-(4-methoxyphenyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 143927359 |
| Molecular Formula | C35H30N8O4 |
| Molecular Weight | 626.68 g/mol |
| Exact Mass | 626.24 |
| IUPAC Name | N-[4-(5-amino-4-cyano-1-pyrimidin-2-ylpyrrol-3-yl)phenyl]acetamide;4-amino-3-hydroxy-N-(4-methoxyphenyl)naphthalene-2-carboxamide |
| SMILES | CC(=O)Nc1ccc(-c2cn(-c3ncccn3)c(N)c2C#N)cc1.COc1ccc(NC(=O)c2cc3ccccc3c(N)c2O)cc1 |
| InChI | InChI=1S/C18H16N2O3.C17H14N6O/c1-23-13-8-6-12(7-9-13)20-18(22)15-10-11-4-2-3-5-14(11)16(19)17(15)21;1-11(24)22-13-5-3-12(4-6-13)15-10-23(16(19)14(15)9-18)17-20-7-2-8-21-17/h2-10,21H,19H2,1H3,(H,20,22);2-8,10H,19H2,1H3,(H,22,24) |
| InChIKey | QAKLAERVLMNZHV-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 194.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.68 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_OH_no_alk_B(1)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|