C29H29N7O2 — CID 143927342
4-amino-3-hydroxy-N-(4-methylphenyl)naphthalene-2-carboxamide;5-amino-1-pyridin-2-ylpyrazole-4-carbonitrile;ethane (PubChem CID 143927342) has the molecular formula C29H29N7O2 and a molecular weight of 507.60 g/mol. Its IUPAC name is 4-amino-3-hydroxy-N-(4-methylphenyl)naphthalene-2-carboxamide;5-amino-1-pyridin-2-ylpyrazole-4-carbonitrile;ethane.
| Compound Name | 4-amino-3-hydroxy-N-(4-methylphenyl)naphthalene-2-carboxamide;5-amino-1-pyridin-2-ylpyrazole-4-carbonitrile;ethane |
|---|---|
| PubChem CID | 143927342 |
| Molecular Formula | C29H29N7O2 |
| Molecular Weight | 507.60 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | 4-amino-3-hydroxy-N-(4-methylphenyl)naphthalene-2-carboxamide;5-amino-1-pyridin-2-ylpyrazole-4-carbonitrile;ethane |
| SMILES | CC.Cc1ccc(NC(=O)c2cc3ccccc3c(N)c2O)cc1.N#Cc1cnn(-c2ccccn2)c1N |
| InChI | InChI=1S/C18H16N2O2.C9H7N5.C2H6/c1-11-6-8-13(9-7-11)20-18(22)15-10-12-4-2-3-5-14(12)16(19)17(15)21;10-5-7-6-13-14(9(7)11)8-3-1-2-4-12-8;1-2/h2-10,21H,19H2,1H3,(H,20,22);1-4,6H,11H2;1-2H3 |
| InChIKey | HRPMGNHTXUTFDP-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 155.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.60 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_OH_no_alk_B(1)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|