C30H24N8O3 — CID 163859214
4-[(4-cyano-1-pyridin-2-ylpyrazol-5-yl)diazenyl]-3-hydroxy-2-N-phenyl-7-N-propylnaphthalene-2,7-dicarboxamide (PubChem CID 163859214) has the molecular formula C30H24N8O3 and a molecular weight of 544.58 g/mol. Its IUPAC name is 4-[(4-cyano-1-pyridin-2-ylpyrazol-5-yl)diazenyl]-3-hydroxy-2-N-phenyl-7-N-propylnaphthalene-2,7-dicarboxamide.
| Compound Name | 4-[(4-cyano-1-pyridin-2-ylpyrazol-5-yl)diazenyl]-3-hydroxy-2-N-phenyl-7-N-propylnaphthalene-2,7-dicarboxamide |
|---|---|
| PubChem CID | 163859214 |
| Molecular Formula | C30H24N8O3 |
| Molecular Weight | 544.58 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | 4-[(4-cyano-1-pyridin-2-ylpyrazol-5-yl)diazenyl]-3-hydroxy-2-N-phenyl-7-N-propylnaphthalene-2,7-dicarboxamide |
| SMILES | CCCNC(=O)c1ccc2c(/N=N/c3c(C#N)cnn3-c3ccccn3)c(O)c(C(=O)Nc3ccccc3)cc2c1 |
| InChI | InChI=1S/C30H24N8O3/c1-2-13-33-29(40)19-11-12-23-20(15-19)16-24(30(41)35-22-8-4-3-5-9-22)27(39)26(23)36-37-28-21(17-31)18-34-38(28)25-10-6-7-14-32-25/h3-12,14-16,18,39H,2,13H2,1H3,(H,33,40)(H,35,41)/b37-36+ |
| InChIKey | PBAMDUVGLMYKSY-BSRQYYOTSA-N |
| XLogP | 5.81 |
| TPSA | 157.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.58 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|