C29H23N7O4 — CID 136642041
4-[(4-carbamoyl-1-methylpyrazol-5-yl)diazenyl]-3-hydroxy-2-N,7-N-diphenylnaphthalene-2,7-dicarboxamide (PubChem CID 136642041) has the molecular formula C29H23N7O4 and a molecular weight of 533.55 g/mol. Its IUPAC name is 4-[(4-carbamoyl-1-methylpyrazol-5-yl)diazenyl]-3-hydroxy-2-N,7-N-diphenylnaphthalene-2,7-dicarboxamide.
| Compound Name | 4-[(4-carbamoyl-1-methylpyrazol-5-yl)diazenyl]-3-hydroxy-2-N,7-N-diphenylnaphthalene-2,7-dicarboxamide |
|---|---|
| PubChem CID | 136642041 |
| Molecular Formula | C29H23N7O4 |
| Molecular Weight | 533.55 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | 4-[(4-carbamoyl-1-methylpyrazol-5-yl)diazenyl]-3-hydroxy-2-N,7-N-diphenylnaphthalene-2,7-dicarboxamide |
| SMILES | Cn1ncc(C(N)=O)c1/N=N/c1c(O)c(C(=O)Nc2ccccc2)cc2cc(C(=O)Nc3ccccc3)ccc12 |
| InChI | InChI=1S/C29H23N7O4/c1-36-27(23(16-31-36)26(30)38)35-34-24-21-13-12-17(28(39)32-19-8-4-2-5-9-19)14-18(21)15-22(25(24)37)29(40)33-20-10-6-3-7-11-20/h2-16,37H,1H3,(H2,30,38)(H,32,39)(H,33,40)/b35-34+ |
| InChIKey | SDGWNPHRPYYPEV-XAHDOWKMSA-N |
| XLogP | 5.30 |
| TPSA | 164.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.55 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|