C23H19N7O4 — CID 136635199
1-(2-amino-2-oxoethyl)-5-[[2-hydroxy-3-(phenylcarbamoyl)naphthalen-1-yl]diazenyl]imidazole-4-carboxamide (PubChem CID 136635199) has the molecular formula C23H19N7O4 and a molecular weight of 457.45 g/mol. Its IUPAC name is 1-(2-amino-2-oxoethyl)-5-[[2-hydroxy-3-(phenylcarbamoyl)naphthalen-1-yl]diazenyl]imidazole-4-carboxamide.
| Compound Name | 1-(2-amino-2-oxoethyl)-5-[[2-hydroxy-3-(phenylcarbamoyl)naphthalen-1-yl]diazenyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 136635199 |
| Molecular Formula | C23H19N7O4 |
| Molecular Weight | 457.45 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 1-(2-amino-2-oxoethyl)-5-[[2-hydroxy-3-(phenylcarbamoyl)naphthalen-1-yl]diazenyl]imidazole-4-carboxamide |
| SMILES | NC(=O)Cn1cnc(C(N)=O)c1/N=N/c1c(O)c(C(=O)Nc2ccccc2)cc2ccccc12 |
| InChI | InChI=1S/C23H19N7O4/c24-17(31)11-30-12-26-19(21(25)33)22(30)29-28-18-15-9-5-4-6-13(15)10-16(20(18)32)23(34)27-14-7-2-1-3-8-14/h1-10,12,32H,11H2,(H2,24,31)(H2,25,33)(H,27,34)/b29-28+ |
| InChIKey | OIYBYWJYHFNAAC-ZQHSETAFSA-N |
| XLogP | 2.99 |
| TPSA | 178.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|