C24H18N6O4 — CID 136598391
2-cyano-5-[[2-hydroxy-3-[[4-(hydroxymethyl)phenyl]carbamoyl]naphthalen-1-yl]diazenyl]-1H-pyrrole-3-carboxamide (PubChem CID 136598391) has the molecular formula C24H18N6O4 and a molecular weight of 454.45 g/mol. Its IUPAC name is 2-cyano-5-[[2-hydroxy-3-[[4-(hydroxymethyl)phenyl]carbamoyl]naphthalen-1-yl]diazenyl]-1H-pyrrole-3-carboxamide.
| Compound Name | 2-cyano-5-[[2-hydroxy-3-[[4-(hydroxymethyl)phenyl]carbamoyl]naphthalen-1-yl]diazenyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 136598391 |
| Molecular Formula | C24H18N6O4 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 2-cyano-5-[[2-hydroxy-3-[[4-(hydroxymethyl)phenyl]carbamoyl]naphthalen-1-yl]diazenyl]-1H-pyrrole-3-carboxamide |
| SMILES | N#Cc1[nH]c(/N=N/c2c(O)c(C(=O)Nc3ccc(CO)cc3)cc3ccccc23)cc1C(N)=O |
| InChI | InChI=1S/C24H18N6O4/c25-11-19-17(23(26)33)10-20(28-19)29-30-21-16-4-2-1-3-14(16)9-18(22(21)32)24(34)27-15-7-5-13(12-31)6-8-15/h1-10,28,31-32H,12H2,(H2,26,33)(H,27,34)/b30-29+ |
| InChIKey | YCYAIFJVDOSTJE-QVIHXGFCSA-N |
| XLogP | 4.00 |
| TPSA | 176.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|