C25H20N4O5 — CID 136994644
N-(4-aminophenyl)-4-[(2,4-diacetylfuran-3-yl)diazenyl]-3-hydroxynaphthalene-2-carboxamide (PubChem CID 136994644) has the molecular formula C25H20N4O5 and a molecular weight of 456.46 g/mol. Its IUPAC name is N-(4-aminophenyl)-4-[(2,4-diacetylfuran-3-yl)diazenyl]-3-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-(4-aminophenyl)-4-[(2,4-diacetylfuran-3-yl)diazenyl]-3-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 136994644 |
| Molecular Formula | C25H20N4O5 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | N-(4-aminophenyl)-4-[(2,4-diacetylfuran-3-yl)diazenyl]-3-hydroxynaphthalene-2-carboxamide |
| SMILES | CC(=O)c1coc(C(C)=O)c1/N=N/c1c(O)c(C(=O)Nc2ccc(N)cc2)cc2ccccc12 |
| InChI | InChI=1S/C25H20N4O5/c1-13(30)20-12-34-24(14(2)31)22(20)29-28-21-18-6-4-3-5-15(18)11-19(23(21)32)25(33)27-17-9-7-16(26)8-10-17/h3-12,32H,26H2,1-2H3,(H,27,33)/b29-28+ |
| InChIKey | SJCGYDPHIJKVNB-ZQHSETAFSA-N |
| XLogP | 5.79 |
| TPSA | 147.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|