C37H28N8O7 — CID 136642037
methyl 5-[[3,6-bis[(4-formamidophenyl)carbamoyl]-2-hydroxynaphthalen-1-yl]diazenyl]-1-phenylpyrazole-4-carboxylate (PubChem CID 136642037) has the molecular formula C37H28N8O7 and a molecular weight of 696.68 g/mol. Its IUPAC name is methyl 5-[[3,6-bis[(4-formamidophenyl)carbamoyl]-2-hydroxynaphthalen-1-yl]diazenyl]-1-phenylpyrazole-4-carboxylate.
| Compound Name | methyl 5-[[3,6-bis[(4-formamidophenyl)carbamoyl]-2-hydroxynaphthalen-1-yl]diazenyl]-1-phenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 136642037 |
| Molecular Formula | C37H28N8O7 |
| Molecular Weight | 696.68 g/mol |
| Exact Mass | 696.21 |
| IUPAC Name | methyl 5-[[3,6-bis[(4-formamidophenyl)carbamoyl]-2-hydroxynaphthalen-1-yl]diazenyl]-1-phenylpyrazole-4-carboxylate |
| SMILES | COC(=O)c1cnn(-c2ccccc2)c1/N=N/c1c(O)c(C(=O)Nc2ccc(NC=O)cc2)cc2cc(C(=O)Nc3ccc(NC=O)cc3)ccc12 |
| InChI | InChI=1S/C37H28N8O7/c1-52-37(51)31-19-40-45(28-5-3-2-4-6-28)34(31)44-43-32-29-16-7-22(35(49)41-26-12-8-24(9-13-26)38-20-46)17-23(29)18-30(33(32)48)36(50)42-27-14-10-25(11-15-27)39-21-47/h2-21,48H,1H3,(H,38,46)(H,39,47)(H,41,49)(H,42,50)/b44-43+ |
| InChIKey | HXVYPLOKFYLKPJ-VGFSZAGXSA-N |
| XLogP | 6.57 |
| TPSA | 205.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.68 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|