C34H41N5O3 — CID 143927355
4-amino-3-hydroxy-N-(4-methoxyphenyl)naphthalene-2-carboxamide;(E)-2-(methyliminomethyl)pent-2-enenitrile;(Z)-N-[(E)-pent-2-en-2-yl]but-2-en-1-imine (PubChem CID 143927355) has the molecular formula C34H41N5O3 and a molecular weight of 567.73 g/mol. Its IUPAC name is 4-amino-3-hydroxy-N-(4-methoxyphenyl)naphthalene-2-carboxamide;(E)-2-(methyliminomethyl)pent-2-enenitrile;(Z)-N-[(E)-pent-2-en-2-yl]but-2-en-1-imine.
| Compound Name | 4-amino-3-hydroxy-N-(4-methoxyphenyl)naphthalene-2-carboxamide;(E)-2-(methyliminomethyl)pent-2-enenitrile;(Z)-N-[(E)-pent-2-en-2-yl]but-2-en-1-imine |
|---|---|
| PubChem CID | 143927355 |
| Molecular Formula | C34H41N5O3 |
| Molecular Weight | 567.73 g/mol |
| Exact Mass | 567.32 |
| IUPAC Name | 4-amino-3-hydroxy-N-(4-methoxyphenyl)naphthalene-2-carboxamide;(E)-2-(methyliminomethyl)pent-2-enenitrile;(Z)-N-[(E)-pent-2-en-2-yl]but-2-en-1-imine |
| SMILES | C/C=C\C=N\C(C)=C\CC.CC/C=C(C#N)\C=N\C.COc1ccc(NC(=O)c2cc3ccccc3c(N)c2O)cc1 |
| InChI | InChI=1S/C18H16N2O3.C9H15N.C7H10N2/c1-23-13-8-6-12(7-9-13)20-18(22)15-10-11-4-2-3-5-14(11)16(19)17(15)21;1-4-6-8-10-9(3)7-5-2;1-3-4-7(5-8)6-9-2/h2-10,21H,19H2,1H3,(H,20,22);4,6-8H,5H2,1-3H3;4,6H,3H2,1-2H3/b;6-4-,9-7+,10-8+;7-4-,9-6+ |
| InChIKey | XDZIQUSMBSPLKQ-NQQOVOSTSA-N |
| XLogP | 7.88 |
| TPSA | 133.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.73 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_OH_no_alk_B(1)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|