C23H27FN2O7S — CID 42988320
[1-[1-(4-fluorophenyl)ethylamino]-1-oxopropan-2-yl] 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate (PubChem CID 42988320) has the molecular formula C23H27FN2O7S and a molecular weight of 494.54 g/mol. Its IUPAC name is [1-[1-(4-fluorophenyl)ethylamino]-1-oxopropan-2-yl] 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate.
| Compound Name | [1-[1-(4-fluorophenyl)ethylamino]-1-oxopropan-2-yl] 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate |
|---|---|
| PubChem CID | 42988320 |
| Molecular Formula | C23H27FN2O7S |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | [1-[1-(4-fluorophenyl)ethylamino]-1-oxopropan-2-yl] 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate |
| SMILES | CC(OC(=O)CCCNS(=O)(=O)c1ccc2c(c1)OCCO2)C(=O)NC(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H27FN2O7S/c1-15(17-5-7-18(24)8-6-17)26-23(28)16(2)33-22(27)4-3-11-25-34(29,30)19-9-10-20-21(14-19)32-13-12-31-20/h5-10,14-16,25H,3-4,11-13H2,1-2H3,(H,26,28) |
| InChIKey | NAZGJECVYSSILG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|