C22H32N2O7S — CID 129421473
[(2S)-1-[[(1R,2R,3S)-2,3-dimethylcyclohexyl]amino]-1-oxopropan-2-yl] 3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)propanoate (PubChem CID 129421473) has the molecular formula C22H32N2O7S and a molecular weight of 468.57 g/mol. Its IUPAC name is [(2S)-1-[[(1R,2R,3S)-2,3-dimethylcyclohexyl]amino]-1-oxopropan-2-yl] 3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)propanoate.
| Compound Name | [(2S)-1-[[(1R,2R,3S)-2,3-dimethylcyclohexyl]amino]-1-oxopropan-2-yl] 3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 129421473 |
| Molecular Formula | C22H32N2O7S |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | [(2S)-1-[[(1R,2R,3S)-2,3-dimethylcyclohexyl]amino]-1-oxopropan-2-yl] 3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)propanoate |
| SMILES | C[C@@H]1[C@@H](C)CCC[C@H]1NC(=O)[C@H](C)OC(=O)CCNS(=O)(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C22H32N2O7S/c1-14-5-4-6-18(15(14)2)24-22(26)16(3)31-21(25)9-10-23-32(27,28)17-7-8-19-20(13-17)30-12-11-29-19/h7-8,13-16,18,23H,4-6,9-12H2,1-3H3,(H,24,26)/t14-,15+,16-,18+/m0/s1 |
| InChIKey | RLWPIYAZFZZMRN-UIBIWLFHSA-N |
| XLogP | 2.00 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |