C16H14ClN3O5S3 — CID 4842022
[2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)butanoate (PubChem CID 4842022) has the molecular formula C16H14ClN3O5S3 and a molecular weight of 459.96 g/mol. Its IUPAC name is [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)butanoate.
| Compound Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)butanoate |
|---|---|
| PubChem CID | 4842022 |
| Molecular Formula | C16H14ClN3O5S3 |
| Molecular Weight | 459.96 g/mol |
| Exact Mass | 458.98 |
| IUPAC Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)butanoate |
| SMILES | O=C(CCCNS(=O)(=O)c1cccc2nsnc12)OCC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C16H14ClN3O5S3/c17-14-7-6-12(26-14)11(21)9-25-15(22)5-2-8-18-28(23,24)13-4-1-3-10-16(13)20-27-19-10/h1,3-4,6-7,18H,2,5,8-9H2 |
| InChIKey | QOUWGFCYRNAYLR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.96 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|