C15H20ClN3O6S — CID 7738856
[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 3-[(4-chlorophenyl)sulfonylamino]propanoate (PubChem CID 7738856) has the molecular formula C15H20ClN3O6S and a molecular weight of 405.86 g/mol. Its IUPAC name is [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 3-[(4-chlorophenyl)sulfonylamino]propanoate.
| Compound Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 3-[(4-chlorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 7738856 |
| Molecular Formula | C15H20ClN3O6S |
| Molecular Weight | 405.86 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 3-[(4-chlorophenyl)sulfonylamino]propanoate |
| SMILES | CC(C)NC(=O)NC(=O)COC(=O)CCNS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H20ClN3O6S/c1-10(2)18-15(22)19-13(20)9-25-14(21)7-8-17-26(23,24)12-5-3-11(16)4-6-12/h3-6,10,17H,7-9H2,1-2H3,(H2,18,19,20,22) |
| InChIKey | ZJWDJBQNCOEWOR-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.86 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |