C17H23ClN2O5S — CID 7738879
[2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl] 3-[(4-chlorophenyl)sulfonylamino]propanoate (PubChem CID 7738879) has the molecular formula C17H23ClN2O5S and a molecular weight of 402.90 g/mol. Its IUPAC name is [2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl] 3-[(4-chlorophenyl)sulfonylamino]propanoate.
| Compound Name | [2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl] 3-[(4-chlorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 7738879 |
| Molecular Formula | C17H23ClN2O5S |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | [2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl] 3-[(4-chlorophenyl)sulfonylamino]propanoate |
| SMILES | C[C@H]1CCCCN1C(=O)COC(=O)CCNS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H23ClN2O5S/c1-13-4-2-3-11-20(13)16(21)12-25-17(22)9-10-19-26(23,24)15-7-5-14(18)6-8-15/h5-8,13,19H,2-4,9-12H2,1H3/t13-/m0/s1 |
| InChIKey | PEHHYEDXYDEPSQ-ZDUSSCGKSA-N |
| XLogP | 1.95 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |