C18H19BrN2O5 — CID 26511537
N-[(5-bromo-2-methoxyphenyl)methyl]-N-methyl-1-(6-nitro-4H-1,3-benzodioxin-8-yl)methanamine (PubChem CID 26511537) has the molecular formula C18H19BrN2O5 and a molecular weight of 423.26 g/mol. Its IUPAC name is N-[(5-bromo-2-methoxyphenyl)methyl]-N-methyl-1-(6-nitro-4H-1,3-benzodioxin-8-yl)methanamine.
| Compound Name | N-[(5-bromo-2-methoxyphenyl)methyl]-N-methyl-1-(6-nitro-4H-1,3-benzodioxin-8-yl)methanamine |
|---|---|
| PubChem CID | 26511537 |
| Molecular Formula | C18H19BrN2O5 |
| Molecular Weight | 423.26 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | N-[(5-bromo-2-methoxyphenyl)methyl]-N-methyl-1-(6-nitro-4H-1,3-benzodioxin-8-yl)methanamine |
| SMILES | COc1ccc(Br)cc1CN(C)Cc1cc([N+](=O)[O-])cc2c1OCOC2 |
| InChI | InChI=1S/C18H19BrN2O5/c1-20(8-12-5-15(19)3-4-17(12)24-2)9-13-6-16(21(22)23)7-14-10-25-11-26-18(13)14/h3-7H,8-11H2,1-2H3 |
| InChIKey | DLNLCDLKVMAEOB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.26 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|