C18H14BrClO4 — CID 8663091
(6-chloro-4H-1,3-benzodioxin-8-yl)methyl (E)-3-(3-bromophenyl)prop-2-enoate (PubChem CID 8663091) has the molecular formula C18H14BrClO4 and a molecular weight of 409.66 g/mol. Its IUPAC name is (6-chloro-4H-1,3-benzodioxin-8-yl)methyl (E)-3-(3-bromophenyl)prop-2-enoate.
| Compound Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl (E)-3-(3-bromophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8663091 |
| Molecular Formula | C18H14BrClO4 |
| Molecular Weight | 409.66 g/mol |
| Exact Mass | 407.98 |
| IUPAC Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl (E)-3-(3-bromophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1cccc(Br)c1)OCc1cc(Cl)cc2c1OCOC2 |
| InChI | InChI=1S/C18H14BrClO4/c19-15-3-1-2-12(6-15)4-5-17(21)23-10-14-8-16(20)7-13-9-22-11-24-18(13)14/h1-8H,9-11H2/b5-4+ |
| InChIKey | QXQPDQNYASVBBG-SNAWJCMRSA-N |
| XLogP | 4.73 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.66 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|