C22H18FNO7 — CID 55445136
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-[5-(2-fluorophenyl)furan-2-yl]propanoate (PubChem CID 55445136) has the molecular formula C22H18FNO7 and a molecular weight of 427.38 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-[5-(2-fluorophenyl)furan-2-yl]propanoate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-[5-(2-fluorophenyl)furan-2-yl]propanoate |
|---|---|
| PubChem CID | 55445136 |
| Molecular Formula | C22H18FNO7 |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-[5-(2-fluorophenyl)furan-2-yl]propanoate |
| SMILES | O=C(CCc1ccc(-c2ccccc2F)o1)OCc1cc([N+](=O)[O-])cc2c1OCOC2 |
| InChI | InChI=1S/C22H18FNO7/c23-19-4-2-1-3-18(19)20-7-5-17(31-20)6-8-21(25)29-12-15-10-16(24(26)27)9-14-11-28-13-30-22(14)15/h1-5,7,9-10H,6,8,11-13H2 |
| InChIKey | XNOVMACLEMQZFS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 101.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|